C42H42 — CID 123476022
5,20-ditert-butyl-9,9,24,24-tetramethyloctacyclo[13.13.2.02,10.03,8.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene (PubChem CID 123476022) has the molecular formula C42H42 and a molecular weight of 546.80 g/mol. Its IUPAC name is 5,20-ditert-butyl-9,9,24,24-tetramethyloctacyclo[13.13.2.02,10.03,8.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene.
| Compound Name | 5,20-ditert-butyl-9,9,24,24-tetramethyloctacyclo[13.13.2.02,10.03,8.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene |
|---|---|
| PubChem CID | 123476022 |
| Molecular Formula | C42H42 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 5,20-ditert-butyl-9,9,24,24-tetramethyloctacyclo[13.13.2.02,10.03,8.012,29.017,25.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15,17(25),18(23),19,21,26(30),27-tetradecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1c(cc3ccc4cc5c(c6ccc1c3c46)C(C)(C)c1ccc(C(C)(C)C)cc1-5)C2(C)C |
| InChI | InChI=1S/C42H42/c1-39(2,3)25-13-17-32-29(21-25)30-19-23-11-12-24-20-34-37(27-15-16-28(36(23)35(24)27)38(30)42(32,9)10)31-22-26(40(4,5)6)14-18-33(31)41(34,7)8/h11-22H,1-10H3 |
| InChIKey | SVPBOZKNLKHCLH-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|