C27H38 — CID 168803063
1,4,6-tritert-butyl-9,9-dimethylfluorene (PubChem CID 168803063) has the molecular formula C27H38 and a molecular weight of 362.60 g/mol. Its IUPAC name is 1,4,6-tritert-butyl-9,9-dimethylfluorene.
| Compound Name | 1,4,6-tritert-butyl-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 168803063 |
| Molecular Formula | C27H38 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 1,4,6-tritert-butyl-9,9-dimethylfluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1c(C(C)(C)C)ccc(C(C)(C)C)c1C2(C)C |
| InChI | InChI=1S/C27H38/c1-24(2,3)17-12-13-19-18(16-17)22-20(25(4,5)6)14-15-21(26(7,8)9)23(22)27(19,10)11/h12-16H,1-11H3 |
| InChIKey | YCIGLVOVVZQSRV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |