C8H10N2 — CID 123990114
bicyclo[4.1.0]hepta-2,4-diene-2-carboximidamide (PubChem CID 123990114) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-2,4-diene-2-carboximidamide.
| Compound Name | bicyclo[4.1.0]hepta-2,4-diene-2-carboximidamide |
|---|---|
| PubChem CID | 123990114 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | bicyclo[4.1.0]hepta-2,4-diene-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CC=CC2CC12 |
| InChI | InChI=1S/C8H10N2/c9-8(10)6-3-1-2-5-4-7(5)6/h1-3,5,7H,4H2,(H3,9,10) |
| InChIKey | TVPWAGYVKYVAAY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|