C5H7F3N2O3 — CID 123990881
(1-amino-4,4,4-trifluoro-1-oxobutan-2-yl)carbamic acid (PubChem CID 123990881) has the molecular formula C5H7F3N2O3 and a molecular weight of 200.12 g/mol. Its IUPAC name is (1-amino-4,4,4-trifluoro-1-oxobutan-2-yl)carbamic acid.
| Compound Name | (1-amino-4,4,4-trifluoro-1-oxobutan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 123990881 |
| Molecular Formula | C5H7F3N2O3 |
| Molecular Weight | 200.12 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (1-amino-4,4,4-trifluoro-1-oxobutan-2-yl)carbamic acid |
| SMILES | NC(=O)C(CC(F)(F)F)NC(=O)O |
| InChI | InChI=1S/C5H7F3N2O3/c6-5(7,8)1-2(3(9)11)10-4(12)13/h2,10H,1H2,(H2,9,11)(H,12,13) |
| InChIKey | SVMOTULZOFNTQV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |