About 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene
5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 123991357) has the molecular formula C10H11BrN2
and a molecular weight of 239.12 g/mol. Its IUPAC name is 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
Analyze 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene?
The IUPAC name of 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (CID 123991357) is 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
What is the SMILES notation for 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene?
The canonical SMILES for 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene is Brc1ccc2c(c1)NC1CCN2C1.
What is the InChIKey of 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene?
The InChIKey is DRPHHOQYXBGIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2/c11-7-1-2-10-9(5-7)12-8-3-4-13(10)6-8/h1-2,5,8,12H,3-4,6H2.
What are the key properties of 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene?
5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene has a molecular weight of 239.12 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,8-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene is sourced from PubChem (CID 123991357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).