C36H64N4 — CID 123992192
1-[10-(4-imino-6-octyl-2,3-dihydropyridin-1-yl)decyl]-N-octylpyridin-4-imine (PubChem CID 123992192) has the molecular formula C36H64N4 and a molecular weight of 552.94 g/mol. Its IUPAC name is 1-[10-(4-imino-6-octyl-2,3-dihydropyridin-1-yl)decyl]-N-octylpyridin-4-imine.
| Compound Name | 1-[10-(4-imino-6-octyl-2,3-dihydropyridin-1-yl)decyl]-N-octylpyridin-4-imine |
|---|---|
| PubChem CID | 123992192 |
| Molecular Formula | C36H64N4 |
| Molecular Weight | 552.94 g/mol |
| Exact Mass | 552.51 |
| IUPAC Name | 1-[10-(4-imino-6-octyl-2,3-dihydropyridin-1-yl)decyl]-N-octylpyridin-4-imine |
| SMILES | [H]/N=C1/C=C(CCCCCCCC)N(CCCCCCCCCCn2ccc(=NCCCCCCCC)cc2)CC1 |
| InChI | InChI=1S/C36H64N4/c1-3-5-7-9-15-19-23-36-33-34(37)24-32-40(36)29-22-18-14-12-11-13-17-21-28-39-30-25-35(26-31-39)38-27-20-16-10-8-6-4-2/h25-26,30-31,33,37H,3-24,27-29,32H2,1-2H3/b37-34+ |
| InChIKey | GQQWNDMSDGBIAE-NFSLGCCLSA-N |
| XLogP | 10.23 |
| TPSA | 44.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.94 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|