C12H24ClNS — CID 174687755
4-methyl-3-octyl-2H-1,3-thiazole;hydrochloride (PubChem CID 174687755) has the molecular formula C12H24ClNS and a molecular weight of 249.85 g/mol. Its IUPAC name is 4-methyl-3-octyl-2H-1,3-thiazole;hydrochloride.
| Compound Name | 4-methyl-3-octyl-2H-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 174687755 |
| Molecular Formula | C12H24ClNS |
| Molecular Weight | 249.85 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-methyl-3-octyl-2H-1,3-thiazole;hydrochloride |
| SMILES | CCCCCCCCN1CSC=C1C.Cl |
| InChI | InChI=1S/C12H23NS.ClH/c1-3-4-5-6-7-8-9-13-11-14-10-12(13)2;/h10H,3-9,11H2,1-2H3;1H |
| InChIKey | UWHRCWILAHECTG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|