C10H20N2 — CID 67688279
5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine (PubChem CID 67688279) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine.
| Compound Name | 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine |
|---|---|
| PubChem CID | 67688279 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine |
| SMILES | CCCCCN1CCNC=C1C |
| InChI | InChI=1S/C10H20N2/c1-3-4-5-7-12-8-6-11-9-10(12)2/h9,11H,3-8H2,1-2H3 |
| InChIKey | PALBVIBBVFRYFU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|