About 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine
5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine (PubChem CID 67688279) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine.
Molecular Properties
| Compound Name | 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine |
| PubChem CID | 67688279 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine |
| SMILES | CCCCCN1CCNC=C1C |
| InChI | InChI=1S/C10H20N2/c1-3-4-5-7-12-8-6-11-9-10(12)2/h9,11H,3-8H2,1-2H3 |
| InChIKey | PALBVIBBVFRYFU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine?
The IUPAC name of 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine (CID 67688279) is 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine.
What is the SMILES notation for 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine?
The canonical SMILES for 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine is CCCCCN1CCNC=C1C.
What is the InChIKey of 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine?
The InChIKey is PALBVIBBVFRYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-3-4-5-7-12-8-6-11-9-10(12)2/h9,11H,3-8H2,1-2H3.
What are the key properties of 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine?
5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine has a molecular weight of 168.28 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-pentyl-2,3-dihydro-1H-pyrazine is sourced from PubChem (CID 67688279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).