About 3-butyl-4-chloro-1,2-dihydroimidazole
3-butyl-4-chloro-1,2-dihydroimidazole (PubChem CID 174297650) has the molecular formula C7H13ClN2
and a molecular weight of 160.65 g/mol. Its IUPAC name is 3-butyl-4-chloro-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3-butyl-4-chloro-1,2-dihydroimidazole |
| PubChem CID | 174297650 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 3-butyl-4-chloro-1,2-dihydroimidazole |
| SMILES | CCCCN1CNC=C1Cl |
| InChI | InChI=1S/C7H13ClN2/c1-2-3-4-10-6-9-5-7(10)8/h5,9H,2-4,6H2,1H3 |
| InChIKey | GBYNVTGZKSKIRT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4-chloro-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-chloro-1,2-dihydroimidazole?
The IUPAC name of 3-butyl-4-chloro-1,2-dihydroimidazole (CID 174297650) is 3-butyl-4-chloro-1,2-dihydroimidazole.
What is the SMILES notation for 3-butyl-4-chloro-1,2-dihydroimidazole?
The canonical SMILES for 3-butyl-4-chloro-1,2-dihydroimidazole is CCCCN1CNC=C1Cl.
What is the InChIKey of 3-butyl-4-chloro-1,2-dihydroimidazole?
The InChIKey is GBYNVTGZKSKIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClN2/c1-2-3-4-10-6-9-5-7(10)8/h5,9H,2-4,6H2,1H3.
What are the key properties of 3-butyl-4-chloro-1,2-dihydroimidazole?
3-butyl-4-chloro-1,2-dihydroimidazole has a molecular weight of 160.65 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-chloro-1,2-dihydroimidazole is sourced from PubChem (CID 174297650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).