C10H22ClN2+ — CID 162358295
1-butyl-2-chloro-3-methyl-4,5-dihydroimidazol-3-ium;ethane (PubChem CID 162358295) has the molecular formula C10H22ClN2+ and a molecular weight of 205.75 g/mol. Its IUPAC name is 1-butyl-2-chloro-3-methyl-4,5-dihydroimidazol-3-ium;ethane.
| Compound Name | 1-butyl-2-chloro-3-methyl-4,5-dihydroimidazol-3-ium;ethane |
|---|---|
| PubChem CID | 162358295 |
| Molecular Formula | C10H22ClN2+ |
| Molecular Weight | 205.75 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-butyl-2-chloro-3-methyl-4,5-dihydroimidazol-3-ium;ethane |
| SMILES | CC.CCCCN1CC[N+](C)=C1Cl |
| InChI | InChI=1S/C8H16ClN2.C2H6/c1-3-4-5-11-7-6-10(2)8(11)9;1-2/h3-7H2,1-2H3;1-2H3/q+1; |
| InChIKey | IUWQYAMMFKQVMI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.75 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|