About 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid
1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid (PubChem CID 138677949) has the molecular formula C12H23N2O2+
and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid |
| PubChem CID | 138677949 |
| Molecular Formula | C12H23N2O2+ |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid |
| SMILES | CCCCCCCN1CC[N+](C)=C1C(=O)O |
| InChI | InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-14-10-9-13(2)11(14)12(15)16/h3-10H2,1-2H3/p+1 |
| InChIKey | CYTKAKVPVLKNPS-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
The IUPAC name of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid (CID 138677949) is 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid.
What is the SMILES notation for 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
The canonical SMILES for 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid is CCCCCCCN1CC[N+](C)=C1C(=O)O.
What is the InChIKey of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
The InChIKey is CYTKAKVPVLKNPS-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-14-10-9-13(2)11(14)12(15)16/h3-10H2,1-2H3/p+1.
What are the key properties of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid?
1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid has a molecular weight of 227.33 g/mol, XLogP of 1.40, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylic acid is sourced from PubChem (CID 138677949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).