C8H18N3+ — CID 162358246
1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-amine (PubChem CID 162358246) has the molecular formula C8H18N3+ and a molecular weight of 156.25 g/mol. Its IUPAC name is 1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-amine.
| Compound Name | 1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 162358246 |
| Molecular Formula | C8H18N3+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 1-butyl-3-methyl-4,5-dihydroimidazol-3-ium-2-amine |
| SMILES | CCCCN1CC[N+](C)=C1N |
| InChI | InChI=1S/C8H17N3/c1-3-4-5-11-7-6-10(2)8(11)9/h9H,3-7H2,1-2H3/p+1 |
| InChIKey | QMVCHADSVQOUJU-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|