C15H30FN2+ — CID 22002619
2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium (PubChem CID 22002619) has the molecular formula C15H30FN2+ and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium.
| Compound Name | 2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 22002619 |
| Molecular Formula | C15H30FN2+ |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2-fluoro-1,3-dihexyl-4,5-dihydroimidazol-1-ium |
| SMILES | CCCCCCN1CC[N+](CCCCCC)=C1F |
| InChI | InChI=1S/C15H30FN2/c1-3-5-7-9-11-17-13-14-18(15(17)16)12-10-8-6-4-2/h3-14H2,1-2H3/q+1 |
| InChIKey | UBIPNURUOBMYRE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|