About 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate
1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate (PubChem CID 138677948) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate.
Molecular Properties
| Compound Name | 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate |
| PubChem CID | 138677948 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate |
| SMILES | CCCCCCCN1CC[N+](C)=C1C(=O)[O-] |
| InChI | InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-14-10-9-13(2)11(14)12(15)16/h3-10H2,1-2H3 |
| InChIKey | CYTKAKVPVLKNPS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate?
The IUPAC name of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate (CID 138677948) is 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate.
What is the SMILES notation for 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate?
The canonical SMILES for 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate is CCCCCCCN1CC[N+](C)=C1C(=O)[O-].
What is the InChIKey of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate?
The InChIKey is CYTKAKVPVLKNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-14-10-9-13(2)11(14)12(15)16/h3-10H2,1-2H3.
What are the key properties of 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate?
1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate has a molecular weight of 226.32 g/mol, XLogP of 0.06, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate is sourced from PubChem (CID 138677948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).