About 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate
1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate (PubChem CID 138678018) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate |
| PubChem CID | 138678018 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate |
| SMILES | CCCCCN1CC[N+](C)=C1C(=O)[O-] |
| InChI | InChI=1S/C10H18N2O2/c1-3-4-5-6-12-8-7-11(2)9(12)10(13)14/h3-8H2,1-2H3 |
| InChIKey | OCBCUMBIPOCOJH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate?
The IUPAC name of 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate (CID 138678018) is 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate.
What is the SMILES notation for 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate?
The canonical SMILES for 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate is CCCCCN1CC[N+](C)=C1C(=O)[O-].
What is the InChIKey of 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate?
The InChIKey is OCBCUMBIPOCOJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-3-4-5-6-12-8-7-11(2)9(12)10(13)14/h3-8H2,1-2H3.
What are the key properties of 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate?
1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate has a molecular weight of 198.27 g/mol, XLogP of -0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-pentyl-4,5-dihydroimidazol-1-ium-2-carboxylate is sourced from PubChem (CID 138678018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).