C10H21N2+ — CID 138638421
1,3-dimethyl-2-pentan-3-yl-4,5-dihydroimidazol-1-ium (PubChem CID 138638421) has the molecular formula C10H21N2+ and a molecular weight of 169.29 g/mol. Its IUPAC name is 1,3-dimethyl-2-pentan-3-yl-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-dimethyl-2-pentan-3-yl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 138638421 |
| Molecular Formula | C10H21N2+ |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.17 |
| IUPAC Name | 1,3-dimethyl-2-pentan-3-yl-4,5-dihydroimidazol-1-ium |
| SMILES | CCC(CC)C1=[N+](C)CCN1C |
| InChI | InChI=1S/C10H21N2/c1-5-9(6-2)10-11(3)7-8-12(10)4/h9H,5-8H2,1-4H3/q+1 |
| InChIKey | QCDLSFBIDJAUCK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|