About 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline
6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline (PubChem CID 83515806) has the molecular formula C12H17BrN2
and a molecular weight of 269.19 g/mol. Its IUPAC name is 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 83515806 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCCCN1CCNc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H17BrN2/c1-2-3-7-15-8-6-14-11-5-4-10(13)9-12(11)15/h4-5,9,14H,2-3,6-8H2,1H3 |
| InChIKey | HVDSUEGSWOMSIT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline (CID 83515806) is 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline is CCCCN1CCNc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is HVDSUEGSWOMSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2/c1-2-3-7-15-8-6-14-11-5-4-10(13)9-12(11)15/h4-5,9,14H,2-3,6-8H2,1H3.
What are the key properties of 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline?
6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 269.19 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-butyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 83515806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).