C12H25N — CID 123993727
N,3,6-trimethyl-5-methylideneoctan-2-amine (PubChem CID 123993727) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is N,3,6-trimethyl-5-methylideneoctan-2-amine.
| Compound Name | N,3,6-trimethyl-5-methylideneoctan-2-amine |
|---|---|
| PubChem CID | 123993727 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N,3,6-trimethyl-5-methylideneoctan-2-amine |
| SMILES | C=C(CC(C)C(C)NC)C(C)CC |
| InChI | InChI=1S/C12H25N/c1-7-9(2)10(3)8-11(4)12(5)13-6/h9,11-13H,3,7-8H2,1-2,4-6H3 |
| InChIKey | QDGWOZNHDJQJTC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|