About 7-fluoro-2,3-dihydroazepin-6-imine
7-fluoro-2,3-dihydroazepin-6-imine (PubChem CID 123993900) has the molecular formula C6H7FN2
and a molecular weight of 126.13 g/mol. Its IUPAC name is 7-fluoro-2,3-dihydroazepin-6-imine.
Molecular Properties
| Compound Name | 7-fluoro-2,3-dihydroazepin-6-imine |
| PubChem CID | 123993900 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | 7-fluoro-2,3-dihydroazepin-6-imine |
| SMILES | [H]/N=C1\C=CCCN=C1F |
| InChI | InChI=1S/C6H7FN2/c7-6-5(8)3-1-2-4-9-6/h1,3,8H,2,4H2/b8-5+ |
| InChIKey | DHKSSRKQGVFESL-VMPITWQZSA-N |
| XLogP | 1.33 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2,3-dihydroazepin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,3-dihydroazepin-6-imine?
The IUPAC name of 7-fluoro-2,3-dihydroazepin-6-imine (CID 123993900) is 7-fluoro-2,3-dihydroazepin-6-imine.
What is the SMILES notation for 7-fluoro-2,3-dihydroazepin-6-imine?
The canonical SMILES for 7-fluoro-2,3-dihydroazepin-6-imine is [H]/N=C1\C=CCCN=C1F.
What is the InChIKey of 7-fluoro-2,3-dihydroazepin-6-imine?
The InChIKey is DHKSSRKQGVFESL-VMPITWQZSA-N. The full InChI is InChI=1S/C6H7FN2/c7-6-5(8)3-1-2-4-9-6/h1,3,8H,2,4H2/b8-5+.
What are the key properties of 7-fluoro-2,3-dihydroazepin-6-imine?
7-fluoro-2,3-dihydroazepin-6-imine has a molecular weight of 126.13 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-dihydroazepin-6-imine is sourced from PubChem (CID 123993900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).