C9H11FN2 — CID 123675010
7-fluoro-2-[(E)-prop-1-enyl]-2,6-dihydroazepin-5-imine (PubChem CID 123675010) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 7-fluoro-2-[(E)-prop-1-enyl]-2,6-dihydroazepin-5-imine.
| Compound Name | 7-fluoro-2-[(E)-prop-1-enyl]-2,6-dihydroazepin-5-imine |
|---|---|
| PubChem CID | 123675010 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 7-fluoro-2-[(E)-prop-1-enyl]-2,6-dihydroazepin-5-imine |
| SMILES | [H]/N=C1/C=CC(/C=C/C)N=C(F)C1 |
| InChI | InChI=1S/C9H11FN2/c1-2-3-8-5-4-7(11)6-9(10)12-8/h2-5,8,11H,6H2,1H3/b3-2+,11-7- |
| InChIKey | VUPADXUEIQXUQA-ICVSQMLFSA-N |
| XLogP | 2.28 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|