C8H12N2 — CID 142810802
(5Z)-4-N-methylhepta-1,5-diene-3,4-diimine (PubChem CID 142810802) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (5Z)-4-N-methylhepta-1,5-diene-3,4-diimine.
| Compound Name | (5Z)-4-N-methylhepta-1,5-diene-3,4-diimine |
|---|---|
| PubChem CID | 142810802 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (5Z)-4-N-methylhepta-1,5-diene-3,4-diimine |
| SMILES | [H]/N=C(\C=C)C(/C=C\C)=NC |
| InChI | InChI=1S/C8H12N2/c1-4-6-8(10-3)7(9)5-2/h4-6,9H,2H2,1,3H3/b6-4-,9-7+,10-8- |
| InChIKey | INZIRFFBWHWRED-RHCKXKOZSA-N |
| XLogP | 1.84 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|