C7H10N2 — CID 20673085
4-N-methylcyclohex-2-ene-1,4-diimine (PubChem CID 20673085) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-N-methylcyclohex-2-ene-1,4-diimine.
| Compound Name | 4-N-methylcyclohex-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 20673085 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-N-methylcyclohex-2-ene-1,4-diimine |
| SMILES | [H]/N=C1/C=C/C(=N\C)CC1 |
| InChI | InChI=1S/C7H10N2/c1-9-7-4-2-6(8)3-5-7/h2,4,8H,3,5H2,1H3/b8-6-,9-7+ |
| InChIKey | HEMPZQRZCIIURY-MKKAVFGOSA-N |
| XLogP | 1.43 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|