C8H16N2 — CID 145190461
(Z,2R)-3-methyliminohept-4-en-2-amine (PubChem CID 145190461) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (Z,2R)-3-methyliminohept-4-en-2-amine.
| Compound Name | (Z,2R)-3-methyliminohept-4-en-2-amine |
|---|---|
| PubChem CID | 145190461 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (Z,2R)-3-methyliminohept-4-en-2-amine |
| SMILES | CC/C=C\C(=N/C)[C@@H](C)N |
| InChI | InChI=1S/C8H16N2/c1-4-5-6-8(10-3)7(2)9/h5-7H,4,9H2,1-3H3/b6-5-,10-8+/t7-/m1/s1 |
| InChIKey | NKQUXSOSNCQNNL-IQOFOUSHSA-N |
| XLogP | 1.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|