C8H14N2 — CID 89277427
(E)-4-ethenyliminohex-2-en-2-amine (PubChem CID 89277427) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (E)-4-ethenyliminohex-2-en-2-amine.
| Compound Name | (E)-4-ethenyliminohex-2-en-2-amine |
|---|---|
| PubChem CID | 89277427 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (E)-4-ethenyliminohex-2-en-2-amine |
| SMILES | C=C/N=C(/C=C(\C)N)CC |
| InChI | InChI=1S/C8H14N2/c1-4-8(10-5-2)6-7(3)9/h5-6H,2,4,9H2,1,3H3/b7-6+,10-8+ |
| InChIKey | INJWSHRQDAYJRR-LQPGMRSMSA-N |
| XLogP | 1.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|