About 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine
1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine (PubChem CID 85431210) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine.
Analyze 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
The IUPAC name of 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine (CID 85431210) is 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine is CC(N)=CC1=NCCC1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
The InChIKey is MIEKTQNVLICORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-6(8)5-7-3-2-4-9-7/h5H,2-4,8H2,1H3.
What are the key properties of 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine has a molecular weight of 124.19 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine is sourced from PubChem (CID 85431210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).