C6H9FN2 — CID 91464248
(3-fluoro-2,3-dihydropyridin-6-yl)methanamine (PubChem CID 91464248) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is (3-fluoro-2,3-dihydropyridin-6-yl)methanamine.
| Compound Name | (3-fluoro-2,3-dihydropyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 91464248 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (3-fluoro-2,3-dihydropyridin-6-yl)methanamine |
| SMILES | NCC1=NCC(F)C=C1 |
| InChI | InChI=1S/C6H9FN2/c7-5-1-2-6(3-8)9-4-5/h1-2,5H,3-4,8H2 |
| InChIKey | WFHKQIZMZAADFJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |