C20H25N3O3S — CID 123994950
tert-butyl 2-[phenyl(1,3-thiazol-2-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 123994950) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is tert-butyl 2-[phenyl(1,3-thiazol-2-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[phenyl(1,3-thiazol-2-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123994950 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl 2-[phenyl(1,3-thiazol-2-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)N(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C20H25N3O3S/c1-20(2,3)26-19(25)22-13-8-7-11-16(22)17(24)23(18-21-12-14-27-18)15-9-5-4-6-10-15/h4-6,9-10,12,14,16H,7-8,11,13H2,1-3H3 |
| InChIKey | YZRBOTDCHTUGOE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |