C22H22N4O3S — CID 91270592
benzyl 2-[(4-aminophenyl)-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 91270592) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is benzyl 2-[(4-aminophenyl)-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(4-aminophenyl)-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91270592 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | benzyl 2-[(4-aminophenyl)-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Nc1ccc(N(C(=O)C2CCCN2C(=O)OCc2ccccc2)c2nccs2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c23-17-8-10-18(11-9-17)26(21-24-12-14-30-21)20(27)19-7-4-13-25(19)22(28)29-15-16-5-2-1-3-6-16/h1-3,5-6,8-12,14,19H,4,7,13,15,23H2 |
| InChIKey | DUTSRZFJLJGXIK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|