C27H30N4O5S — CID 91460577
benzyl 2-[[4-[methoxy(propyl)carbamoyl]phenyl]-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 91460577) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is benzyl 2-[[4-[methoxy(propyl)carbamoyl]phenyl]-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[[4-[methoxy(propyl)carbamoyl]phenyl]-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91460577 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | benzyl 2-[[4-[methoxy(propyl)carbamoyl]phenyl]-(1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCCN(OC)C(=O)c1ccc(N(C(=O)C2CCCN2C(=O)OCc2ccccc2)c2nccs2)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-3-16-30(35-2)24(32)21-11-13-22(14-12-21)31(26-28-15-18-37-26)25(33)23-10-7-17-29(23)27(34)36-19-20-8-5-4-6-9-20/h4-6,8-9,11-15,18,23H,3,7,10,16-17,19H2,1-2H3 |
| InChIKey | HKOOSBJVKVXOCZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|