C25H24N2O4 — CID 90904602
benzyl 2-[(3-hydroxyphenyl)-phenylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90904602) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is benzyl 2-[(3-hydroxyphenyl)-phenylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(3-hydroxyphenyl)-phenylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90904602 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | benzyl 2-[(3-hydroxyphenyl)-phenylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(C1CCCN1C(=O)OCc1ccccc1)N(c1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C25H24N2O4/c28-22-14-7-13-21(17-22)27(20-11-5-2-6-12-20)24(29)23-15-8-16-26(23)25(30)31-18-19-9-3-1-4-10-19/h1-7,9-14,17,23,28H,8,15-16,18H2 |
| InChIKey | ZTZLIVMQQNAUHC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |