C29H23Cl2N3O5 — CID 91448532
benzyl 2-[(3,4-dichloro-2,5-dioxopyrrol-1-yl)-(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 91448532) has the molecular formula C29H23Cl2N3O5 and a molecular weight of 564.43 g/mol. Its IUPAC name is benzyl 2-[(3,4-dichloro-2,5-dioxopyrrol-1-yl)-(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(3,4-dichloro-2,5-dioxopyrrol-1-yl)-(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91448532 |
| Molecular Formula | C29H23Cl2N3O5 |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | benzyl 2-[(3,4-dichloro-2,5-dioxopyrrol-1-yl)-(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC1C(=O)N(c1cccc(-c2ccccc2)c1)N1C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C29H23Cl2N3O5/c30-24-25(31)28(37)34(27(24)36)33(22-14-7-13-21(17-22)20-11-5-2-6-12-20)26(35)23-15-8-16-32(23)29(38)39-18-19-9-3-1-4-10-19/h1-7,9-14,17,23H,8,15-16,18H2 |
| InChIKey | HZTQQGQUBBBTHW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|