C25H23N3O6 — CID 91552658
benzyl 2-[(4-nitrophenoxy)-phenylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 91552658) has the molecular formula C25H23N3O6 and a molecular weight of 461.47 g/mol. Its IUPAC name is benzyl 2-[(4-nitrophenoxy)-phenylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(4-nitrophenoxy)-phenylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91552658 |
| Molecular Formula | C25H23N3O6 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | benzyl 2-[(4-nitrophenoxy)-phenylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(C1CCCN1C(=O)OCc1ccccc1)N(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O6/c29-24(23-12-7-17-26(23)25(30)33-18-19-8-3-1-4-9-19)27(20-10-5-2-6-11-20)34-22-15-13-21(14-16-22)28(31)32/h1-6,8-11,13-16,23H,7,12,17-18H2 |
| InChIKey | CVQCFFQQTYEUEK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|