C25H29N3O6S — CID 70051616
benzyl (2R)-2-[(2S)-2-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 70051616) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is benzyl (2R)-2-[(2S)-2-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(2S)-2-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70051616 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | benzyl (2R)-2-[(2S)-2-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@H]1C(=O)N1CCC[C@H]1C(O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H29N3O6S/c29-23(17-35-20-12-10-19(11-13-20)28(32)33)21-8-4-14-26(21)24(30)22-9-5-15-27(22)25(31)34-16-18-6-2-1-3-7-18/h1-3,6-7,10-13,21-23,29H,4-5,8-9,14-17H2/t21-,22+,23?/m0/s1 |
| InChIKey | UQVSOJMWJHOMIJ-ZVTBYLAHSA-N |
| XLogP | 3.84 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|