C14H22O — CID 123996559
7-methyl-7-(2-methylpentoxy)cyclohepta-1,3,5-triene (PubChem CID 123996559) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 7-methyl-7-(2-methylpentoxy)cyclohepta-1,3,5-triene.
| Compound Name | 7-methyl-7-(2-methylpentoxy)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123996559 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 7-methyl-7-(2-methylpentoxy)cyclohepta-1,3,5-triene |
| SMILES | CCCC(C)COC1(C)C=CC=CC=C1 |
| InChI | InChI=1S/C14H22O/c1-4-9-13(2)12-15-14(3)10-7-5-6-8-11-14/h5-8,10-11,13H,4,9,12H2,1-3H3 |
| InChIKey | QKBLGRYLEUCQJG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |