C11H16FN2+ — CID 123998348
N-ethyl-5-fluoro-3-propan-2-yl-1-azoniacyclohepta-1,3,5,7-tetraen-4-amine (PubChem CID 123998348) has the molecular formula C11H16FN2+ and a molecular weight of 195.26 g/mol. Its IUPAC name is N-ethyl-5-fluoro-3-propan-2-yl-1-azoniacyclohepta-1,3,5,7-tetraen-4-amine.
| Compound Name | N-ethyl-5-fluoro-3-propan-2-yl-1-azoniacyclohepta-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 123998348 |
| Molecular Formula | C11H16FN2+ |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-ethyl-5-fluoro-3-propan-2-yl-1-azoniacyclohepta-1,3,5,7-tetraen-4-amine |
| SMILES | CCNC1=C(C(C)C)C=[N+]=CC=C1F |
| InChI | InChI=1S/C11H15FN2/c1-4-14-11-9(8(2)3)7-13-6-5-10(11)12/h5-8H,4H2,1-3H3/p+1 |
| InChIKey | YYMGZZJSQOWYIY-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|