C19H17N9 — CID 1240078
2-N,6-N-bis(benzotriazol-1-ylmethyl)pyridine-2,6-diamine (PubChem CID 1240078) has the molecular formula C19H17N9 and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-N,6-N-bis(benzotriazol-1-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(benzotriazol-1-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 1240078 |
| Molecular Formula | C19H17N9 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-N,6-N-bis(benzotriazol-1-ylmethyl)pyridine-2,6-diamine |
| SMILES | c1cc(NCn2nnc3ccccc32)nc(NCn2nnc3ccccc32)c1 |
| InChI | InChI=1S/C19H17N9/c1-3-8-16-14(6-1)23-25-27(16)12-20-18-10-5-11-19(22-18)21-13-28-17-9-4-2-7-15(17)24-26-28/h1-11H,12-13H2,(H2,20,21,22) |
| InChIKey | HARFREWNQIJFSN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |