C14H11N5O — CID 3365598
N-(benzotriazol-1-ylmethyl)-1,3-benzoxazol-4-amine (PubChem CID 3365598) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is N-(benzotriazol-1-ylmethyl)-1,3-benzoxazol-4-amine.
| Compound Name | N-(benzotriazol-1-ylmethyl)-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 3365598 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(benzotriazol-1-ylmethyl)-1,3-benzoxazol-4-amine |
| SMILES | c1ccc2c(c1)nnn2CNc1cccc2ocnc12 |
| InChI | InChI=1S/C14H11N5O/c1-2-6-12-10(4-1)17-18-19(12)8-15-11-5-3-7-13-14(11)16-9-20-13/h1-7,9,15H,8H2 |
| InChIKey | VKFWZIAKWXPXJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |