About N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline
N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline (PubChem CID 761479) has the molecular formula C13H10Cl2N4
and a molecular weight of 293.16 g/mol. Its IUPAC name is N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline.
Molecular Properties
| Compound Name | N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline |
| PubChem CID | 761479 |
| Molecular Formula | C13H10Cl2N4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline |
| SMILES | Clc1cccc(NCn2nnc3ccccc32)c1Cl |
| InChI | InChI=1S/C13H10Cl2N4/c14-9-4-3-6-11(13(9)15)16-8-19-12-7-2-1-5-10(12)17-18-19/h1-7,16H,8H2 |
| InChIKey | CKZSPQIIOBZZRC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline?
The IUPAC name of N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline (CID 761479) is N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline.
What is the SMILES notation for N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline?
The canonical SMILES for N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline is Clc1cccc(NCn2nnc3ccccc32)c1Cl.
What is the InChIKey of N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline?
The InChIKey is CKZSPQIIOBZZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N4/c14-9-4-3-6-11(13(9)15)16-8-19-12-7-2-1-5-10(12)17-18-19/h1-7,16H,8H2.
What are the key properties of N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline?
N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline has a molecular weight of 293.16 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzotriazol-1-ylmethyl)-2,3-dichloroaniline is sourced from PubChem (CID 761479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).