C25H27N3O3 — CID 1240763
N-[(3S,7R,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-4-nitrobenzamide (PubChem CID 1240763) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[(3S,7R,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-4-nitrobenzamide.
| Compound Name | N-[(3S,7R,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1240763 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[(3S,7R,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cc2c3c(c1)[C@@H]1CCC[C@@H]1CN3C[C@H]1CCC[C@@H]21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H27N3O3/c29-25(15-7-9-19(10-8-15)28(30)31)26-18-11-22-20-5-1-3-16(20)13-27-14-17-4-2-6-21(17)23(12-18)24(22)27/h7-12,16-17,20-21H,1-6,13-14H2,(H,26,29)/t16-,17-,20-,21-/m1/s1 |
| InChIKey | DVVOTUXKOYRRNA-DEPWHIHDSA-N |
| XLogP | 5.45 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|