C19H13F3N4S — CID 1244091
(8S,8aR)-6-amino-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile (PubChem CID 1244091) has the molecular formula C19H13F3N4S and a molecular weight of 386.40 g/mol. Its IUPAC name is (8S,8aR)-6-amino-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-6-amino-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 1244091 |
| Molecular Formula | C19H13F3N4S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (8S,8aR)-6-amino-8-[2-(trifluoromethyl)phenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccccc2C(F)(F)F)[C@H]2CSCC=C12 |
| InChI | InChI=1S/C19H13F3N4S/c20-19(21,22)15-4-2-1-3-12(15)16-14-8-27-6-5-11(14)13(7-23)17(26)18(16,9-24)10-25/h1-5,14,16H,6,8,26H2/t14-,16+/m0/s1 |
| InChIKey | UAPYAUOPIUSTSK-GOEBONIOSA-N |
| XLogP | 3.86 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|