About (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one
(3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one (PubChem CID 124503214) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one.
Molecular Properties
| Compound Name | (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one |
| PubChem CID | 124503214 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)[C@H](N)[C@@H]2c2ccc(C)o2)cc1OC |
| InChI | InChI=1S/C17H20N2O4/c1-10-4-6-13(23-10)16-15(18)17(20)19(16)9-11-5-7-12(21-2)14(8-11)22-3/h4-8,15-16H,9,18H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | HTYDLQHASXTDHG-CVEARBPZSA-N |
| XLogP | 2.02 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one?
The IUPAC name of (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one (CID 124503214) is (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one.
What is the SMILES notation for (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one?
The canonical SMILES for (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one is COc1ccc(CN2C(=O)[C@H](N)[C@@H]2c2ccc(C)o2)cc1OC.
What is the InChIKey of (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one?
The InChIKey is HTYDLQHASXTDHG-CVEARBPZSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-10-4-6-13(23-10)16-15(18)17(20)19(16)9-11-5-7-12(21-2)14(8-11)22-3/h4-8,15-16H,9,18H2,1-3H3/t15-,16+/m1/s1.
What are the key properties of (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one?
(3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one has a molecular weight of 316.36 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(5-methylfuran-2-yl)azetidin-2-one is sourced from PubChem (CID 124503214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).