About 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one
3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one (PubChem CID 70575146) has the molecular formula C16H18N2O4
and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one.
Molecular Properties
| Compound Name | 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one |
| PubChem CID | 70575146 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)C(N)C2c2ccco2)cc1OC |
| InChI | InChI=1S/C16H18N2O4/c1-20-11-6-5-10(8-13(11)21-2)9-18-15(14(17)16(18)19)12-4-3-7-22-12/h3-8,14-15H,9,17H2,1-2H3 |
| InChIKey | FRSNDYLJWQTRKO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one?
The IUPAC name of 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one (CID 70575146) is 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one.
What is the SMILES notation for 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one?
The canonical SMILES for 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one is COc1ccc(CN2C(=O)C(N)C2c2ccco2)cc1OC.
What is the InChIKey of 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one?
The InChIKey is FRSNDYLJWQTRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4/c1-20-11-6-5-10(8-13(11)21-2)9-18-15(14(17)16(18)19)12-4-3-7-22-12/h3-8,14-15H,9,17H2,1-2H3.
What are the key properties of 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one?
3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one has a molecular weight of 302.33 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(3,4-dimethoxyphenyl)methyl]-4-(furan-2-yl)azetidin-2-one is sourced from PubChem (CID 70575146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).