C17H22ClFN2O2 — CID 124504771
N-(3-chloro-4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 124504771) has the molecular formula C17H22ClFN2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 124504771 |
| Molecular Formula | C17H22ClFN2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C1CCN(C[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H22ClFN2O2/c18-15-10-13(3-4-16(15)19)20-17(22)12-5-7-21(8-6-12)11-14-2-1-9-23-14/h3-4,10,12,14H,1-2,5-9,11H2,(H,20,22)/t14-/m1/s1 |
| InChIKey | SGTKSNVIWYQFQY-CQSZACIVSA-N |
| XLogP | 3.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |