C13H11N5O3 — CID 124506094
7-methoxy-4-oxo-N-(1H-1,2,4-triazol-5-yl)-1H-quinoline-3-carboxamide (PubChem CID 124506094) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 7-methoxy-4-oxo-N-(1H-1,2,4-triazol-5-yl)-1H-quinoline-3-carboxamide.
| Compound Name | 7-methoxy-4-oxo-N-(1H-1,2,4-triazol-5-yl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 124506094 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 7-methoxy-4-oxo-N-(1H-1,2,4-triazol-5-yl)-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc2c(=O)c(C(=O)Nc3ncn[nH]3)c[nH]c2c1 |
| InChI | InChI=1S/C13H11N5O3/c1-21-7-2-3-8-10(4-7)14-5-9(11(8)19)12(20)17-13-15-6-16-18-13/h2-6H,1H3,(H,14,19)(H2,15,16,17,18,20) |
| InChIKey | OFEBQRJVUCWCPT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |