C9H17NO2 — CID 124509762
(5R)-5-hexyl-1,3-oxazolidin-2-one (PubChem CID 124509762) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (5R)-5-hexyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-hexyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 124509762 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (5R)-5-hexyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@@H]1CNC(=O)O1 |
| InChI | InChI=1S/C9H17NO2/c1-2-3-4-5-6-8-7-10-9(11)12-8/h8H,2-7H2,1H3,(H,10,11)/t8-/m1/s1 |
| InChIKey | GRSGHOQURGCDFQ-MRVPVSSYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|