C23H29N3O3 — CID 124518899
5-[3-(1-adamantylcarbamoyl)indazol-1-yl]pentanoic acid (PubChem CID 124518899) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 5-[3-(1-adamantylcarbamoyl)indazol-1-yl]pentanoic acid.
| Compound Name | 5-[3-(1-adamantylcarbamoyl)indazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 124518899 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 5-[3-(1-adamantylcarbamoyl)indazol-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1nc(C(=O)NC23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O3/c27-20(28)7-3-4-8-26-19-6-2-1-5-18(19)21(25-26)22(29)24-23-12-15-9-16(13-23)11-17(10-15)14-23/h1-2,5-6,15-17H,3-4,7-14H2,(H,24,29)(H,27,28) |
| InChIKey | CMCIJYXHEYJYQU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|