C27H36N4O4 — CID 121249269
6-[3-(1-adamantylcarbamoyl)-4-methyl-5-phenylpyrazol-1-yl]hexyl nitrate (PubChem CID 121249269) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is 6-[3-(1-adamantylcarbamoyl)-4-methyl-5-phenylpyrazol-1-yl]hexyl nitrate.
| Compound Name | 6-[3-(1-adamantylcarbamoyl)-4-methyl-5-phenylpyrazol-1-yl]hexyl nitrate |
|---|---|
| PubChem CID | 121249269 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 6-[3-(1-adamantylcarbamoyl)-4-methyl-5-phenylpyrazol-1-yl]hexyl nitrate |
| SMILES | Cc1c(C(=O)NC23CC4CC(CC(C4)C2)C3)nn(CCCCCCO[N+](=O)[O-])c1-c1ccccc1 |
| InChI | InChI=1S/C27H36N4O4/c1-19-24(26(32)28-27-16-20-13-21(17-27)15-22(14-20)18-27)29-30(25(19)23-9-5-4-6-10-23)11-7-2-3-8-12-35-31(33)34/h4-6,9-10,20-22H,2-3,7-8,11-18H2,1H3,(H,28,32) |
| InChIKey | QHEDBUOHVKGJGO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|