C25H34N4O3 — CID 147511627
N-(2-adamantyl)-1-[7-(hydroxyamino)-7-oxoheptyl]indazole-3-carboxamide (PubChem CID 147511627) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-(2-adamantyl)-1-[7-(hydroxyamino)-7-oxoheptyl]indazole-3-carboxamide.
| Compound Name | N-(2-adamantyl)-1-[7-(hydroxyamino)-7-oxoheptyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 147511627 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-(2-adamantyl)-1-[7-(hydroxyamino)-7-oxoheptyl]indazole-3-carboxamide |
| SMILES | O=C(CCCCCCn1nc(C(=O)NC2C3CC4CC(C3)CC2C4)c2ccccc21)NO |
| InChI | InChI=1S/C25H34N4O3/c30-22(28-32)9-3-1-2-6-10-29-21-8-5-4-7-20(21)24(27-29)25(31)26-23-18-12-16-11-17(14-18)15-19(23)13-16/h4-5,7-8,16-19,23,32H,1-3,6,9-15H2,(H,26,31)(H,28,30) |
| InChIKey | FJKNOBWYTIDZFS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|