C17H21NO5 — CID 124527192
[(1S,2R,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2R)-2,3-dihydroxy-2-phenylpropanoate (PubChem CID 124527192) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is [(1S,2R,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2R)-2,3-dihydroxy-2-phenylpropanoate.
| Compound Name | [(1S,2R,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2R)-2,3-dihydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 124527192 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [(1S,2R,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2R)-2,3-dihydroxy-2-phenylpropanoate |
| SMILES | CN1[C@H]2CC(OC(=O)[C@](O)(CO)c3ccccc3)C[C@H]1[C@H]1O[C@@H]12 |
| InChI | InChI=1S/C17H21NO5/c1-18-12-7-11(8-13(18)15-14(12)23-15)22-16(20)17(21,9-19)10-5-3-2-4-6-10/h2-6,11-15,19,21H,7-9H2,1H3/t12-,13-,14+,15+,17-/m0/s1 |
| InChIKey | JEJREKXHLFEVHN-XGYYKPKNSA-N |
| XLogP | 0.02 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|