C32H35N5O3 — CID 124540079
(1S,3aS,8bR)-3a-amino-1-N,8b-N-dibenzyl-2-cyclohexyl-3-oxo-1,4-dihydropyrrolo[3,4-b]indole-1,8b-dicarboxamide (PubChem CID 124540079) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is (1S,3aS,8bR)-3a-amino-1-N,8b-N-dibenzyl-2-cyclohexyl-3-oxo-1,4-dihydropyrrolo[3,4-b]indole-1,8b-dicarboxamide.
| Compound Name | (1S,3aS,8bR)-3a-amino-1-N,8b-N-dibenzyl-2-cyclohexyl-3-oxo-1,4-dihydropyrrolo[3,4-b]indole-1,8b-dicarboxamide |
|---|---|
| PubChem CID | 124540079 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (1S,3aS,8bR)-3a-amino-1-N,8b-N-dibenzyl-2-cyclohexyl-3-oxo-1,4-dihydropyrrolo[3,4-b]indole-1,8b-dicarboxamide |
| SMILES | N[C@]12Nc3ccccc3[C@@]1(C(=O)NCc1ccccc1)[C@@H](C(=O)NCc1ccccc1)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C32H35N5O3/c33-32-30(40)37(24-16-8-3-9-17-24)27(28(38)34-20-22-12-4-1-5-13-22)31(32,25-18-10-11-19-26(25)36-32)29(39)35-21-23-14-6-2-7-15-23/h1-2,4-7,10-15,18-19,24,27,36H,3,8-9,16-17,20-21,33H2,(H,34,38)(H,35,39)/t27-,31+,32-/m1/s1 |
| InChIKey | ORLZBMOREWSGLL-RKVVATLDSA-N |
| XLogP | 3.18 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |